About methyl-[(3Z)-2-methylhexa-3,5-dien-3-yl]diazene
methyl-[(3Z)-2-methylhexa-3,5-dien-3-yl]diazene (PubChem CID 167311236) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is methyl-[(3Z)-2-methylhexa-3,5-dien-3-yl]diazene.
Molecular Properties
| Compound Name | methyl-[(3Z)-2-methylhexa-3,5-dien-3-yl]diazene |
| PubChem CID | 167311236 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | methyl-[(3Z)-2-methylhexa-3,5-dien-3-yl]diazene |
| SMILES | C=C/C=C(\N=N\C)C(C)C |
| InChI | InChI=1S/C8H14N2/c1-5-6-8(7(2)3)10-9-4/h5-7H,1H2,2-4H3/b8-6-,10-9+ |
| InChIKey | OEFWZXLTWSROGO-JWJWWGMXSA-N |
| XLogP | 2.79 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl-[(3Z)-2-methylhexa-3,5-dien-3-yl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[(3Z)-2-methylhexa-3,5-dien-3-yl]diazene?
The IUPAC name of methyl-[(3Z)-2-methylhexa-3,5-dien-3-yl]diazene (CID 167311236) is methyl-[(3Z)-2-methylhexa-3,5-dien-3-yl]diazene.
What is the SMILES notation for methyl-[(3Z)-2-methylhexa-3,5-dien-3-yl]diazene?
The canonical SMILES for methyl-[(3Z)-2-methylhexa-3,5-dien-3-yl]diazene is C=C/C=C(\N=N\C)C(C)C.
What is the InChIKey of methyl-[(3Z)-2-methylhexa-3,5-dien-3-yl]diazene?
The InChIKey is OEFWZXLTWSROGO-JWJWWGMXSA-N. The full InChI is InChI=1S/C8H14N2/c1-5-6-8(7(2)3)10-9-4/h5-7H,1H2,2-4H3/b8-6-,10-9+.
What are the key properties of methyl-[(3Z)-2-methylhexa-3,5-dien-3-yl]diazene?
methyl-[(3Z)-2-methylhexa-3,5-dien-3-yl]diazene has a molecular weight of 138.21 g/mol, XLogP of 2.79, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[(3Z)-2-methylhexa-3,5-dien-3-yl]diazene is sourced from PubChem (CID 167311236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).