C50H42FN5O6 — CID 167311458
5-fluoro-2,4,6-tris(4-methoxy-N-(4-methoxyphenyl)anilino)benzene-1,3-dicarbonitrile (PubChem CID 167311458) has the molecular formula C50H42FN5O6 and a molecular weight of 827.91 g/mol. Its IUPAC name is 5-fluoro-2,4,6-tris(4-methoxy-N-(4-methoxyphenyl)anilino)benzene-1,3-dicarbonitrile.
| Compound Name | 5-fluoro-2,4,6-tris(4-methoxy-N-(4-methoxyphenyl)anilino)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 167311458 |
| Molecular Formula | C50H42FN5O6 |
| Molecular Weight | 827.91 g/mol |
| Exact Mass | 827.31 |
| IUPAC Name | 5-fluoro-2,4,6-tris(4-methoxy-N-(4-methoxyphenyl)anilino)benzene-1,3-dicarbonitrile |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2c(F)c(N(c3ccc(OC)cc3)c3ccc(OC)cc3)c(C#N)c(N(c3ccc(OC)cc3)c3ccc(OC)cc3)c2C#N)cc1 |
| InChI | InChI=1S/C50H42FN5O6/c1-57-39-19-7-33(8-20-39)54(34-9-21-40(58-2)22-10-34)48-45(31-52)49(55(35-11-23-41(59-3)24-12-35)36-13-25-42(60-4)26-14-36)47(51)50(46(48)32-53)56(37-15-27-43(61-5)28-16-37)38-17-29-44(62-6)30-18-38/h7-30H,1-6H3 |
| InChIKey | CUOBNPQADWMTHK-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 112.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.91 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |