C12H19ClN2O — CID 167311617
[1-(pyridin-2-ylmethyl)piperidin-3-yl]methanol;hydrochloride (PubChem CID 167311617) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is [1-(pyridin-2-ylmethyl)piperidin-3-yl]methanol;hydrochloride.
| Compound Name | [1-(pyridin-2-ylmethyl)piperidin-3-yl]methanol;hydrochloride |
|---|---|
| PubChem CID | 167311617 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | [1-(pyridin-2-ylmethyl)piperidin-3-yl]methanol;hydrochloride |
| SMILES | Cl.OCC1CCCN(Cc2ccccn2)C1 |
| InChI | InChI=1S/C12H18N2O.ClH/c15-10-11-4-3-7-14(8-11)9-12-5-1-2-6-13-12;/h1-2,5-6,11,15H,3-4,7-10H2;1H |
| InChIKey | IGMBAFQKCPALLB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |