About 2-bromo-6-(1,3,2-dioxaborinan-2-yl)benzonitrile
2-bromo-6-(1,3,2-dioxaborinan-2-yl)benzonitrile (PubChem CID 167311812) has the molecular formula C10H9BBrNO2
and a molecular weight of 265.90 g/mol. Its IUPAC name is 2-bromo-6-(1,3,2-dioxaborinan-2-yl)benzonitrile.
Molecular Properties
| Compound Name | 2-bromo-6-(1,3,2-dioxaborinan-2-yl)benzonitrile |
| PubChem CID | 167311812 |
| Molecular Formula | C10H9BBrNO2 |
| Molecular Weight | 265.90 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 2-bromo-6-(1,3,2-dioxaborinan-2-yl)benzonitrile |
| SMILES | N#Cc1c(Br)cccc1B1OCCCO1 |
| InChI | InChI=1S/C10H9BBrNO2/c12-10-4-1-3-9(8(10)7-13)11-14-5-2-6-15-11/h1,3-4H,2,5-6H2 |
| InChIKey | IHIDEVCQEFJNPP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.90 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-(1,3,2-dioxaborinan-2-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-(1,3,2-dioxaborinan-2-yl)benzonitrile?
The IUPAC name of 2-bromo-6-(1,3,2-dioxaborinan-2-yl)benzonitrile (CID 167311812) is 2-bromo-6-(1,3,2-dioxaborinan-2-yl)benzonitrile.
What is the SMILES notation for 2-bromo-6-(1,3,2-dioxaborinan-2-yl)benzonitrile?
The canonical SMILES for 2-bromo-6-(1,3,2-dioxaborinan-2-yl)benzonitrile is N#Cc1c(Br)cccc1B1OCCCO1.
What is the InChIKey of 2-bromo-6-(1,3,2-dioxaborinan-2-yl)benzonitrile?
The InChIKey is IHIDEVCQEFJNPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BBrNO2/c12-10-4-1-3-9(8(10)7-13)11-14-5-2-6-15-11/h1,3-4H,2,5-6H2.
What are the key properties of 2-bromo-6-(1,3,2-dioxaborinan-2-yl)benzonitrile?
2-bromo-6-(1,3,2-dioxaborinan-2-yl)benzonitrile has a molecular weight of 265.90 g/mol, XLogP of 1.45, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-(1,3,2-dioxaborinan-2-yl)benzonitrile is sourced from PubChem (CID 167311812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).