C19H14Cl2FN7O — CID 167312214
1-(2,6-dichloro-4-pyridinyl)-3-[[4-(4-fluorophenyl)-1-methylpyrazolo[5,4-b]pyridin-6-yl]amino]urea (PubChem CID 167312214) has the molecular formula C19H14Cl2FN7O and a molecular weight of 446.27 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)-3-[[4-(4-fluorophenyl)-1-methylpyrazolo[5,4-b]pyridin-6-yl]amino]urea.
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)-3-[[4-(4-fluorophenyl)-1-methylpyrazolo[5,4-b]pyridin-6-yl]amino]urea |
|---|---|
| PubChem CID | 167312214 |
| Molecular Formula | C19H14Cl2FN7O |
| Molecular Weight | 446.27 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)-3-[[4-(4-fluorophenyl)-1-methylpyrazolo[5,4-b]pyridin-6-yl]amino]urea |
| SMILES | Cn1ncc2c(-c3ccc(F)cc3)cc(NNC(=O)Nc3cc(Cl)nc(Cl)c3)nc21 |
| InChI | InChI=1S/C19H14Cl2FN7O/c1-29-18-14(9-23-29)13(10-2-4-11(22)5-3-10)8-17(26-18)27-28-19(30)24-12-6-15(20)25-16(21)7-12/h2-9H,1H3,(H,26,27)(H2,24,25,28,30) |
| InChIKey | MBIPPXGZZKZFBA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.27 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|