C29H24F3N7O4 — CID 167314246
2-(6-methoxy-2-methylquinolin-4-yl)-5-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-7-[(2-nitroimidazol-1-yl)methyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 167314246) has the molecular formula C29H24F3N7O4 and a molecular weight of 591.55 g/mol. Its IUPAC name is 2-(6-methoxy-2-methylquinolin-4-yl)-5-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-7-[(2-nitroimidazol-1-yl)methyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-(6-methoxy-2-methylquinolin-4-yl)-5-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-7-[(2-nitroimidazol-1-yl)methyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 167314246 |
| Molecular Formula | C29H24F3N7O4 |
| Molecular Weight | 591.55 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | 2-(6-methoxy-2-methylquinolin-4-yl)-5-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]-7-[(2-nitroimidazol-1-yl)methyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | COc1ccc2nc(C)cc(N3CCc4c(cc(Cn5ccnc5[N+](=O)[O-])cc4-c4cn(C)nc4C(F)(F)F)C3=O)c2c1 |
| InChI | InChI=1S/C29H24F3N7O4/c1-16-10-25(22-13-18(43-3)4-5-24(22)34-16)38-8-6-19-20(23-15-36(2)35-26(23)29(30,31)32)11-17(12-21(19)27(38)40)14-37-9-7-33-28(37)39(41)42/h4-5,7,9-13,15H,6,8,14H2,1-3H3 |
| InChIKey | YYAXXIZRWOUECC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 121.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|