About (4-phenylpiperidin-4-yl) 2-amino-3-bromobenzoate
(4-phenylpiperidin-4-yl) 2-amino-3-bromobenzoate (PubChem CID 167315414) has the molecular formula C18H19BrN2O2
and a molecular weight of 375.27 g/mol. Its IUPAC name is (4-phenylpiperidin-4-yl) 2-amino-3-bromobenzoate.
Molecular Properties
| Compound Name | (4-phenylpiperidin-4-yl) 2-amino-3-bromobenzoate |
| PubChem CID | 167315414 |
| Molecular Formula | C18H19BrN2O2 |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (4-phenylpiperidin-4-yl) 2-amino-3-bromobenzoate |
| SMILES | Nc1c(Br)cccc1C(=O)OC1(c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C18H19BrN2O2/c19-15-8-4-7-14(16(15)20)17(22)23-18(9-11-21-12-10-18)13-5-2-1-3-6-13/h1-8,21H,9-12,20H2 |
| InChIKey | LPIAMAJDNGZSKF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-phenylpiperidin-4-yl) 2-amino-3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylpiperidin-4-yl) 2-amino-3-bromobenzoate?
The IUPAC name of (4-phenylpiperidin-4-yl) 2-amino-3-bromobenzoate (CID 167315414) is (4-phenylpiperidin-4-yl) 2-amino-3-bromobenzoate.
What is the SMILES notation for (4-phenylpiperidin-4-yl) 2-amino-3-bromobenzoate?
The canonical SMILES for (4-phenylpiperidin-4-yl) 2-amino-3-bromobenzoate is Nc1c(Br)cccc1C(=O)OC1(c2ccccc2)CCNCC1.
What is the InChIKey of (4-phenylpiperidin-4-yl) 2-amino-3-bromobenzoate?
The InChIKey is LPIAMAJDNGZSKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19BrN2O2/c19-15-8-4-7-14(16(15)20)17(22)23-18(9-11-21-12-10-18)13-5-2-1-3-6-13/h1-8,21H,9-12,20H2.
What are the key properties of (4-phenylpiperidin-4-yl) 2-amino-3-bromobenzoate?
(4-phenylpiperidin-4-yl) 2-amino-3-bromobenzoate has a molecular weight of 375.27 g/mol, XLogP of 3.47, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylpiperidin-4-yl) 2-amino-3-bromobenzoate is sourced from PubChem (CID 167315414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).