C16H12N4S — CID 16731587
2-(1H-benzimidazol-2-yl)-5-(1,3-thiazol-2-yl)aniline (PubChem CID 16731587) has the molecular formula C16H12N4S and a molecular weight of 292.37 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-5-(1,3-thiazol-2-yl)aniline.
| Compound Name | 2-(1H-benzimidazol-2-yl)-5-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 16731587 |
| Molecular Formula | C16H12N4S |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-5-(1,3-thiazol-2-yl)aniline |
| SMILES | Nc1cc(-c2nccs2)ccc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H12N4S/c17-12-9-10(16-18-7-8-21-16)5-6-11(12)15-19-13-3-1-2-4-14(13)20-15/h1-9H,17H2,(H,19,20) |
| InChIKey | IWYBDRYLKQCQBF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|