About (4-phenylpiperidin-4-yl) 4-(4-chlorophenyl)-3-methyl-4-oxobutanoate
(4-phenylpiperidin-4-yl) 4-(4-chlorophenyl)-3-methyl-4-oxobutanoate (PubChem CID 167315893) has the molecular formula C22H24ClNO3
and a molecular weight of 385.89 g/mol. Its IUPAC name is (4-phenylpiperidin-4-yl) 4-(4-chlorophenyl)-3-methyl-4-oxobutanoate.
Molecular Properties
| Compound Name | (4-phenylpiperidin-4-yl) 4-(4-chlorophenyl)-3-methyl-4-oxobutanoate |
| PubChem CID | 167315893 |
| Molecular Formula | C22H24ClNO3 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | (4-phenylpiperidin-4-yl) 4-(4-chlorophenyl)-3-methyl-4-oxobutanoate |
| SMILES | CC(CC(=O)OC1(c2ccccc2)CCNCC1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H24ClNO3/c1-16(21(26)17-7-9-19(23)10-8-17)15-20(25)27-22(11-13-24-14-12-22)18-5-3-2-4-6-18/h2-10,16,24H,11-15H2,1H3 |
| InChIKey | MHEAEXYAJTVRFF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-phenylpiperidin-4-yl) 4-(4-chlorophenyl)-3-methyl-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylpiperidin-4-yl) 4-(4-chlorophenyl)-3-methyl-4-oxobutanoate?
The IUPAC name of (4-phenylpiperidin-4-yl) 4-(4-chlorophenyl)-3-methyl-4-oxobutanoate (CID 167315893) is (4-phenylpiperidin-4-yl) 4-(4-chlorophenyl)-3-methyl-4-oxobutanoate.
What is the SMILES notation for (4-phenylpiperidin-4-yl) 4-(4-chlorophenyl)-3-methyl-4-oxobutanoate?
The canonical SMILES for (4-phenylpiperidin-4-yl) 4-(4-chlorophenyl)-3-methyl-4-oxobutanoate is CC(CC(=O)OC1(c2ccccc2)CCNCC1)C(=O)c1ccc(Cl)cc1.
What is the InChIKey of (4-phenylpiperidin-4-yl) 4-(4-chlorophenyl)-3-methyl-4-oxobutanoate?
The InChIKey is MHEAEXYAJTVRFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24ClNO3/c1-16(21(26)17-7-9-19(23)10-8-17)15-20(25)27-22(11-13-24-14-12-22)18-5-3-2-4-6-18/h2-10,16,24H,11-15H2,1H3.
What are the key properties of (4-phenylpiperidin-4-yl) 4-(4-chlorophenyl)-3-methyl-4-oxobutanoate?
(4-phenylpiperidin-4-yl) 4-(4-chlorophenyl)-3-methyl-4-oxobutanoate has a molecular weight of 385.89 g/mol, XLogP of 4.37, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylpiperidin-4-yl) 4-(4-chlorophenyl)-3-methyl-4-oxobutanoate is sourced from PubChem (CID 167315893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).