About (4-phenylpiperidin-4-yl) (E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate
(4-phenylpiperidin-4-yl) (E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 167315974) has the molecular formula C21H20N2O3
and a molecular weight of 348.40 g/mol. Its IUPAC name is (4-phenylpiperidin-4-yl) (E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | (4-phenylpiperidin-4-yl) (E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate |
| PubChem CID | 167315974 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (4-phenylpiperidin-4-yl) (E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | N#C/C(=C\c1ccc(O)cc1)C(=O)OC1(c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C21H20N2O3/c22-15-17(14-16-6-8-19(24)9-7-16)20(25)26-21(10-12-23-13-11-21)18-4-2-1-3-5-18/h1-9,14,23-24H,10-13H2/b17-14+ |
| InChIKey | FZCWRQCGEFSYER-SAPNQHFASA-N |
| XLogP | 3.12 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4-phenylpiperidin-4-yl) (E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylpiperidin-4-yl) (E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate?
The IUPAC name of (4-phenylpiperidin-4-yl) (E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate (CID 167315974) is (4-phenylpiperidin-4-yl) (E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate.
What is the SMILES notation for (4-phenylpiperidin-4-yl) (E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate?
The canonical SMILES for (4-phenylpiperidin-4-yl) (E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate is N#C/C(=C\c1ccc(O)cc1)C(=O)OC1(c2ccccc2)CCNCC1.
What is the InChIKey of (4-phenylpiperidin-4-yl) (E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate?
The InChIKey is FZCWRQCGEFSYER-SAPNQHFASA-N. The full InChI is InChI=1S/C21H20N2O3/c22-15-17(14-16-6-8-19(24)9-7-16)20(25)26-21(10-12-23-13-11-21)18-4-2-1-3-5-18/h1-9,14,23-24H,10-13H2/b17-14+.
What are the key properties of (4-phenylpiperidin-4-yl) (E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate?
(4-phenylpiperidin-4-yl) (E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate has a molecular weight of 348.40 g/mol, XLogP of 3.12, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylpiperidin-4-yl) (E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate is sourced from PubChem (CID 167315974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).