About (4-phenylpiperidin-4-yl) 2-(4-methylsulfonylphenyl)acetate
(4-phenylpiperidin-4-yl) 2-(4-methylsulfonylphenyl)acetate (PubChem CID 167316272) has the molecular formula C20H23NO4S
and a molecular weight of 373.47 g/mol. Its IUPAC name is (4-phenylpiperidin-4-yl) 2-(4-methylsulfonylphenyl)acetate.
Molecular Properties
| Compound Name | (4-phenylpiperidin-4-yl) 2-(4-methylsulfonylphenyl)acetate |
| PubChem CID | 167316272 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (4-phenylpiperidin-4-yl) 2-(4-methylsulfonylphenyl)acetate |
| SMILES | CS(=O)(=O)c1ccc(CC(=O)OC2(c3ccccc3)CCNCC2)cc1 |
| InChI | InChI=1S/C20H23NO4S/c1-26(23,24)18-9-7-16(8-10-18)15-19(22)25-20(11-13-21-14-12-20)17-5-3-2-4-6-17/h2-10,21H,11-15H2,1H3 |
| InChIKey | KRNDPIYWEGACMX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-phenylpiperidin-4-yl) 2-(4-methylsulfonylphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylpiperidin-4-yl) 2-(4-methylsulfonylphenyl)acetate?
The IUPAC name of (4-phenylpiperidin-4-yl) 2-(4-methylsulfonylphenyl)acetate (CID 167316272) is (4-phenylpiperidin-4-yl) 2-(4-methylsulfonylphenyl)acetate.
What is the SMILES notation for (4-phenylpiperidin-4-yl) 2-(4-methylsulfonylphenyl)acetate?
The canonical SMILES for (4-phenylpiperidin-4-yl) 2-(4-methylsulfonylphenyl)acetate is CS(=O)(=O)c1ccc(CC(=O)OC2(c3ccccc3)CCNCC2)cc1.
What is the InChIKey of (4-phenylpiperidin-4-yl) 2-(4-methylsulfonylphenyl)acetate?
The InChIKey is KRNDPIYWEGACMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO4S/c1-26(23,24)18-9-7-16(8-10-18)15-19(22)25-20(11-13-21-14-12-20)17-5-3-2-4-6-17/h2-10,21H,11-15H2,1H3.
What are the key properties of (4-phenylpiperidin-4-yl) 2-(4-methylsulfonylphenyl)acetate?
(4-phenylpiperidin-4-yl) 2-(4-methylsulfonylphenyl)acetate has a molecular weight of 373.47 g/mol, XLogP of 2.45, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylpiperidin-4-yl) 2-(4-methylsulfonylphenyl)acetate is sourced from PubChem (CID 167316272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).