C21H16F3NO5S — CID 16731646
dimethyl (2R,10aR)-2-[4-(trifluoromethyl)phenyl]-2,10a-dihydro-[1,3]oxazino[2,3-b][1,3]benzothiazole-3,4-dicarboxylate (PubChem CID 16731646) has the molecular formula C21H16F3NO5S and a molecular weight of 451.42 g/mol. Its IUPAC name is dimethyl (2R,10aR)-2-[4-(trifluoromethyl)phenyl]-2,10a-dihydro-[1,3]oxazino[2,3-b][1,3]benzothiazole-3,4-dicarboxylate.
| Compound Name | dimethyl (2R,10aR)-2-[4-(trifluoromethyl)phenyl]-2,10a-dihydro-[1,3]oxazino[2,3-b][1,3]benzothiazole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 16731646 |
| Molecular Formula | C21H16F3NO5S |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | dimethyl (2R,10aR)-2-[4-(trifluoromethyl)phenyl]-2,10a-dihydro-[1,3]oxazino[2,3-b][1,3]benzothiazole-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N2c3ccccc3S[C@H]2O[C@@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H16F3NO5S/c1-28-18(26)15-16(19(27)29-2)25-13-5-3-4-6-14(13)31-20(25)30-17(15)11-7-9-12(10-8-11)21(22,23)24/h3-10,17,20H,1-2H3/t17-,20-/m1/s1 |
| InChIKey | RAUHEZMVOFDBCD-YLJYHZDGSA-N |
| XLogP | 4.27 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |