C15H18FN3O2S — CID 167316533
N-[1-[2-(4-amino-3-fluorophenoxy)-1,3-thiazol-4-yl]-2-methylpropan-2-yl]acetamide (PubChem CID 167316533) has the molecular formula C15H18FN3O2S and a molecular weight of 323.39 g/mol. Its IUPAC name is N-[1-[2-(4-amino-3-fluorophenoxy)-1,3-thiazol-4-yl]-2-methylpropan-2-yl]acetamide.
| Compound Name | N-[1-[2-(4-amino-3-fluorophenoxy)-1,3-thiazol-4-yl]-2-methylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 167316533 |
| Molecular Formula | C15H18FN3O2S |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-[1-[2-(4-amino-3-fluorophenoxy)-1,3-thiazol-4-yl]-2-methylpropan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)(C)Cc1csc(Oc2ccc(N)c(F)c2)n1 |
| InChI | InChI=1S/C15H18FN3O2S/c1-9(20)19-15(2,3)7-10-8-22-14(18-10)21-11-4-5-13(17)12(16)6-11/h4-6,8H,7,17H2,1-3H3,(H,19,20) |
| InChIKey | OOJPNIHQLKJHMV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|