C10H15NO — CID 167317667
2-methyl-3,4,4a,8a-tetrahydro-1H-isoquinolin-8-ol (PubChem CID 167317667) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-methyl-3,4,4a,8a-tetrahydro-1H-isoquinolin-8-ol.
| Compound Name | 2-methyl-3,4,4a,8a-tetrahydro-1H-isoquinolin-8-ol |
|---|---|
| PubChem CID | 167317667 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2-methyl-3,4,4a,8a-tetrahydro-1H-isoquinolin-8-ol |
| SMILES | CN1CCC2C=CC=C(O)C2C1 |
| InChI | InChI=1S/C10H15NO/c1-11-6-5-8-3-2-4-10(12)9(8)7-11/h2-4,8-9,12H,5-7H2,1H3 |
| InChIKey | BURHRAQYSIMDCV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |