About 6-methyl-2,3-di(propan-2-yl)-3,4-dihydro-2H-pyran
6-methyl-2,3-di(propan-2-yl)-3,4-dihydro-2H-pyran (PubChem CID 167317830) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is 6-methyl-2,3-di(propan-2-yl)-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 6-methyl-2,3-di(propan-2-yl)-3,4-dihydro-2H-pyran |
| PubChem CID | 167317830 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 6-methyl-2,3-di(propan-2-yl)-3,4-dihydro-2H-pyran |
| SMILES | CC1=CCC(C(C)C)C(C(C)C)O1 |
| InChI | InChI=1S/C12H22O/c1-8(2)11-7-6-10(5)13-12(11)9(3)4/h6,8-9,11-12H,7H2,1-5H3 |
| InChIKey | GQUSZUUYVQMHSG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methyl-2,3-di(propan-2-yl)-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,3-di(propan-2-yl)-3,4-dihydro-2H-pyran?
The IUPAC name of 6-methyl-2,3-di(propan-2-yl)-3,4-dihydro-2H-pyran (CID 167317830) is 6-methyl-2,3-di(propan-2-yl)-3,4-dihydro-2H-pyran.
What is the SMILES notation for 6-methyl-2,3-di(propan-2-yl)-3,4-dihydro-2H-pyran?
The canonical SMILES for 6-methyl-2,3-di(propan-2-yl)-3,4-dihydro-2H-pyran is CC1=CCC(C(C)C)C(C(C)C)O1.
What is the InChIKey of 6-methyl-2,3-di(propan-2-yl)-3,4-dihydro-2H-pyran?
The InChIKey is GQUSZUUYVQMHSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O/c1-8(2)11-7-6-10(5)13-12(11)9(3)4/h6,8-9,11-12H,7H2,1-5H3.
What are the key properties of 6-methyl-2,3-di(propan-2-yl)-3,4-dihydro-2H-pyran?
6-methyl-2,3-di(propan-2-yl)-3,4-dihydro-2H-pyran has a molecular weight of 182.31 g/mol, XLogP of 3.61, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,3-di(propan-2-yl)-3,4-dihydro-2H-pyran is sourced from PubChem (CID 167317830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).