C31H30FN7O3S — CID 167318440
6-(2-amino-1,3-benzothiazol-4-yl)-7-fluoro-4-(4-methyl-2-propan-2-yl-3-pyridinyl)-1-(1-prop-2-enoylpiperidin-4-yl)pyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 167318440) has the molecular formula C31H30FN7O3S and a molecular weight of 599.69 g/mol. Its IUPAC name is 6-(2-amino-1,3-benzothiazol-4-yl)-7-fluoro-4-(4-methyl-2-propan-2-yl-3-pyridinyl)-1-(1-prop-2-enoylpiperidin-4-yl)pyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 6-(2-amino-1,3-benzothiazol-4-yl)-7-fluoro-4-(4-methyl-2-propan-2-yl-3-pyridinyl)-1-(1-prop-2-enoylpiperidin-4-yl)pyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 167318440 |
| Molecular Formula | C31H30FN7O3S |
| Molecular Weight | 599.69 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | 6-(2-amino-1,3-benzothiazol-4-yl)-7-fluoro-4-(4-methyl-2-propan-2-yl-3-pyridinyl)-1-(1-prop-2-enoylpiperidin-4-yl)pyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | C=CC(=O)N1CCC(n2c(=O)c(=O)n(-c3c(C)ccnc3C(C)C)c3nc(-c4cccc5sc(N)nc45)c(F)cc32)CC1 |
| InChI | InChI=1S/C31H30FN7O3S/c1-5-23(40)37-13-10-18(11-14-37)38-21-15-20(32)25(19-7-6-8-22-26(19)36-31(33)43-22)35-28(21)39(30(42)29(38)41)27-17(4)9-12-34-24(27)16(2)3/h5-9,12,15-16,18H,1,10-11,13-14H2,2-4H3,(H2,33,36) |
| InChIKey | GVPBDBZCXMYGPQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 129.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|