C16H15Cl2N3O3 — CID 16731863
6-[4-(2,5-dichlorophenoxy)piperidin-1-yl]pyridazine-3-carboxylic acid (PubChem CID 16731863) has the molecular formula C16H15Cl2N3O3 and a molecular weight of 368.22 g/mol. Its IUPAC name is 6-[4-(2,5-dichlorophenoxy)piperidin-1-yl]pyridazine-3-carboxylic acid.
| Compound Name | 6-[4-(2,5-dichlorophenoxy)piperidin-1-yl]pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 16731863 |
| Molecular Formula | C16H15Cl2N3O3 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 6-[4-(2,5-dichlorophenoxy)piperidin-1-yl]pyridazine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(N2CCC(Oc3cc(Cl)ccc3Cl)CC2)nn1 |
| InChI | InChI=1S/C16H15Cl2N3O3/c17-10-1-2-12(18)14(9-10)24-11-5-7-21(8-6-11)15-4-3-13(16(22)23)19-20-15/h1-4,9,11H,5-8H2,(H,22,23) |
| InChIKey | XWXJDWBNWFEYPL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |