C26H26N8O3 — CID 167318830
US11834453, Example 197 (PubChem CID 167318830) has the molecular formula C26H26N8O3 and a molecular weight of 498.50 g/mol. Its IUPAC name is (3R,4S)-4-methoxy-1-[4-[3-methyl-4-(1-methylbenzimidazol-5-yl)oxyanilino]pyrimido[5,4-d]pyrimidin-6-yl]pyrrolidin-3-ol.
| Compound Name | US11834453, Example 197 |
|---|---|
| PubChem CID | 167318830 |
| Molecular Formula | C26H26N8O3 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | (3R,4S)-4-methoxy-1-[4-[3-methyl-4-(1-methylbenzimidazol-5-yl)oxyanilino]pyrimido[5,4-d]pyrimidin-6-yl]pyrrolidin-3-ol |
| SMILES | CC1=C(C=CC(=C1)NC2=NC=NC3=CN=C(N=C32)N4C[C@H]([C@H](C4)OC)O)OC5=CC6=C(C=C5)N(C=N6)C |
| InChI | InChI=1S/C26H26N8O3/c1-15-8-16(4-7-22(15)37-17-5-6-20-18(9-17)30-14-33(20)2)31-25-24-19(28-13-29-25)10-27-26(32-24)34-11-21(35)23(12-34)36-3/h4-10,13-14,21,23,35H,11-12H2,1-3H3,(H,28,29,31)/t21-,23+/m1/s1 |
| InChIKey | TUMFSYQOGHILKG-GGAORHGYSA-N |
| XLogP | 2.70 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | 765 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |