C17H21F5N5O+ — CID 167319576
(2R)-2-[(8S)-5-(4,4-difluorocyclohexyl)-8-methyl-3,6,9,11-tetraza-5-azoniatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-10-yl]-1,1,1-trifluoropropan-2-ol (PubChem CID 167319576) has the molecular formula C17H21F5N5O+ and a molecular weight of 406.38 g/mol. Its IUPAC name is (2R)-2-[(8S)-5-(4,4-difluorocyclohexyl)-8-methyl-3,6,9,11-tetraza-5-azoniatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-10-yl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2R)-2-[(8S)-5-(4,4-difluorocyclohexyl)-8-methyl-3,6,9,11-tetraza-5-azoniatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-10-yl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 167319576 |
| Molecular Formula | C17H21F5N5O+ |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (2R)-2-[(8S)-5-(4,4-difluorocyclohexyl)-8-methyl-3,6,9,11-tetraza-5-azoniatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-10-yl]-1,1,1-trifluoropropan-2-ol |
| SMILES | C[C@H]1Cn2c(nc[n+]2C2CCC(F)(F)CC2)-c2cnc([C@@](C)(O)C(F)(F)F)n21 |
| InChI | InChI=1S/C17H21F5N5O/c1-10-8-25-13(24-9-26(25)11-3-5-16(18,19)6-4-11)12-7-23-14(27(10)12)15(2,28)17(20,21)22/h7,9-11,28H,3-6,8H2,1-2H3/q+1/t10-,15+/m0/s1 |
| InChIKey | JKKLJXLFVGZCBP-ZUZCIYMTSA-N |
| XLogP | 3.13 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|