C34H60O7Si — CID 16732035
(4aS,4bR,8R,8aS,10R,10aS)-2-(3-hydroxypropyl)-8,10-bis(methoxymethoxy)-4a,6-dimethyl-1-[2-tri(propan-2-yl)silyloxyethyl]-4,4b,5,8,8a,9,10,10a-octahydrophenanthren-3-one (PubChem CID 16732035) has the molecular formula C34H60O7Si and a molecular weight of 608.93 g/mol. Its IUPAC name is (4aS,4bR,8R,8aS,10R,10aS)-2-(3-hydroxypropyl)-8,10-bis(methoxymethoxy)-4a,6-dimethyl-1-[2-tri(propan-2-yl)silyloxyethyl]-4,4b,5,8,8a,9,10,10a-octahydrophenanthren-3-one.
| Compound Name | (4aS,4bR,8R,8aS,10R,10aS)-2-(3-hydroxypropyl)-8,10-bis(methoxymethoxy)-4a,6-dimethyl-1-[2-tri(propan-2-yl)silyloxyethyl]-4,4b,5,8,8a,9,10,10a-octahydrophenanthren-3-one |
|---|---|
| PubChem CID | 16732035 |
| Molecular Formula | C34H60O7Si |
| Molecular Weight | 608.93 g/mol |
| Exact Mass | 608.41 |
| IUPAC Name | (4aS,4bR,8R,8aS,10R,10aS)-2-(3-hydroxypropyl)-8,10-bis(methoxymethoxy)-4a,6-dimethyl-1-[2-tri(propan-2-yl)silyloxyethyl]-4,4b,5,8,8a,9,10,10a-octahydrophenanthren-3-one |
| SMILES | COCO[C@H]1C=C(C)C[C@@H]2[C@@H]1C[C@@H](OCOC)[C@@H]1C(CCO[Si](C(C)C)(C(C)C)C(C)C)=C(CCCO)C(=O)C[C@@]21C |
| InChI | InChI=1S/C34H60O7Si/c1-22(2)42(23(3)4,24(5)6)41-15-13-27-26(12-11-14-35)30(36)19-34(8)29-16-25(7)17-31(39-20-37-9)28(29)18-32(33(27)34)40-21-38-10/h17,22-24,28-29,31-33,35H,11-16,18-21H2,1-10H3/t28-,29+,31-,32+,33-,34-/m0/s1 |
| InChIKey | FMMTXMCYMPQVNF-XOFKTFCOSA-N |
| XLogP | 7.20 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.93 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|