C26H22ClFN10O2 — CID 167320417
7-amino-12-chloro-10-[2-[4-(2-fluoro-4-isocyanophenyl)piperazin-1-yl]ethyl]-4-pyridin-2-yl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylic acid (PubChem CID 167320417) has the molecular formula C26H22ClFN10O2 and a molecular weight of 560.98 g/mol. Its IUPAC name is 7-amino-12-chloro-10-[2-[4-(2-fluoro-4-isocyanophenyl)piperazin-1-yl]ethyl]-4-pyridin-2-yl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylic acid.
| Compound Name | 7-amino-12-chloro-10-[2-[4-(2-fluoro-4-isocyanophenyl)piperazin-1-yl]ethyl]-4-pyridin-2-yl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylic acid |
|---|---|
| PubChem CID | 167320417 |
| Molecular Formula | C26H22ClFN10O2 |
| Molecular Weight | 560.98 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | 7-amino-12-chloro-10-[2-[4-(2-fluoro-4-isocyanophenyl)piperazin-1-yl]ethyl]-4-pyridin-2-yl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylic acid |
| SMILES | [C-]#[N+]c1ccc(N2CCN(CCn3c(C(=O)O)c(Cl)c4c3nc(N)n3nc(-c5ccccn5)nc43)CC2)c(F)c1 |
| InChI | InChI=1S/C26H22ClFN10O2/c1-30-15-5-6-18(16(28)14-15)36-11-8-35(9-12-36)10-13-37-21(25(39)40)20(27)19-23(37)33-26(29)38-24(19)32-22(34-38)17-4-2-3-7-31-17/h2-7,14H,8-13H2,(H2,29,33)(H,39,40) |
| InChIKey | UYKRAEBOFJXTBU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 135.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.98 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|