C20H14ClN3O5 — CID 16732168
methyl 4-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]benzoate (PubChem CID 16732168) has the molecular formula C20H14ClN3O5 and a molecular weight of 411.80 g/mol. Its IUPAC name is methyl 4-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]benzoate.
| Compound Name | methyl 4-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]benzoate |
|---|---|
| PubChem CID | 16732168 |
| Molecular Formula | C20H14ClN3O5 |
| Molecular Weight | 411.80 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | methyl 4-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2[nH]c(=O)c3[nH]c4cc(Cl)ccc4c(=O)c3c2=O)cc1 |
| InChI | InChI=1S/C20H14ClN3O5/c1-29-20(28)11-4-2-10(3-5-11)9-24-19(27)15-16(18(26)23-24)22-14-8-12(21)6-7-13(14)17(15)25/h2-8H,9H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | QDJOQDJWGUVCQX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.80 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|