C24H23N5O2 — CID 16732295
3-benzyl-5-[6-(4-phenoxypiperidin-1-yl)pyridazin-3-yl]-1,2,4-oxadiazole (PubChem CID 16732295) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 3-benzyl-5-[6-(4-phenoxypiperidin-1-yl)pyridazin-3-yl]-1,2,4-oxadiazole.
| Compound Name | 3-benzyl-5-[6-(4-phenoxypiperidin-1-yl)pyridazin-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 16732295 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 3-benzyl-5-[6-(4-phenoxypiperidin-1-yl)pyridazin-3-yl]-1,2,4-oxadiazole |
| SMILES | c1ccc(Cc2noc(-c3ccc(N4CCC(Oc5ccccc5)CC4)nn3)n2)cc1 |
| InChI | InChI=1S/C24H23N5O2/c1-3-7-18(8-4-1)17-22-25-24(31-28-22)21-11-12-23(27-26-21)29-15-13-20(14-16-29)30-19-9-5-2-6-10-19/h1-12,20H,13-17H2 |
| InChIKey | ZGLPQRSDHLPYMT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 77.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |