About N'-(5,6-difluoro-1H-indol-3-yl)-N-[(3R)-spiro[4.5]decan-3-yl]oxamide
N'-(5,6-difluoro-1H-indol-3-yl)-N-[(3R)-spiro[4.5]decan-3-yl]oxamide (PubChem CID 167322962) has the molecular formula C20H23F2N3O2
and a molecular weight of 375.42 g/mol. Its IUPAC name is N'-(5,6-difluoro-1H-indol-3-yl)-N-[(3R)-spiro[4.5]decan-3-yl]oxamide.
Molecular Properties
| Compound Name | N'-(5,6-difluoro-1H-indol-3-yl)-N-[(3R)-spiro[4.5]decan-3-yl]oxamide |
| PubChem CID | 167322962 |
| Molecular Formula | C20H23F2N3O2 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N'-(5,6-difluoro-1H-indol-3-yl)-N-[(3R)-spiro[4.5]decan-3-yl]oxamide |
| SMILES | O=C(Nc1c[nH]c2cc(F)c(F)cc12)C(=O)N[C@@H]1CCC2(CCCCC2)C1 |
| InChI | InChI=1S/C20H23F2N3O2/c21-14-8-13-16(9-15(14)22)23-11-17(13)25-19(27)18(26)24-12-4-7-20(10-12)5-2-1-3-6-20/h8-9,11-12,23H,1-7,10H2,(H,24,26)(H,25,27)/t12-/m1/s1 |
| InChIKey | GMRDLNOYQAKBFM-GFCCVEGCSA-N |
| XLogP | 4.00 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-(5,6-difluoro-1H-indol-3-yl)-N-[(3R)-spiro[4.5]decan-3-yl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5,6-difluoro-1H-indol-3-yl)-N-[(3R)-spiro[4.5]decan-3-yl]oxamide?
The IUPAC name of N'-(5,6-difluoro-1H-indol-3-yl)-N-[(3R)-spiro[4.5]decan-3-yl]oxamide (CID 167322962) is N'-(5,6-difluoro-1H-indol-3-yl)-N-[(3R)-spiro[4.5]decan-3-yl]oxamide.
What is the SMILES notation for N'-(5,6-difluoro-1H-indol-3-yl)-N-[(3R)-spiro[4.5]decan-3-yl]oxamide?
The canonical SMILES for N'-(5,6-difluoro-1H-indol-3-yl)-N-[(3R)-spiro[4.5]decan-3-yl]oxamide is O=C(Nc1c[nH]c2cc(F)c(F)cc12)C(=O)N[C@@H]1CCC2(CCCCC2)C1.
What is the InChIKey of N'-(5,6-difluoro-1H-indol-3-yl)-N-[(3R)-spiro[4.5]decan-3-yl]oxamide?
The InChIKey is GMRDLNOYQAKBFM-GFCCVEGCSA-N. The full InChI is InChI=1S/C20H23F2N3O2/c21-14-8-13-16(9-15(14)22)23-11-17(13)25-19(27)18(26)24-12-4-7-20(10-12)5-2-1-3-6-20/h8-9,11-12,23H,1-7,10H2,(H,24,26)(H,25,27)/t12-/m1/s1.
What are the key properties of N'-(5,6-difluoro-1H-indol-3-yl)-N-[(3R)-spiro[4.5]decan-3-yl]oxamide?
N'-(5,6-difluoro-1H-indol-3-yl)-N-[(3R)-spiro[4.5]decan-3-yl]oxamide has a molecular weight of 375.42 g/mol, XLogP of 4.00, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5,6-difluoro-1H-indol-3-yl)-N-[(3R)-spiro[4.5]decan-3-yl]oxamide is sourced from PubChem (CID 167322962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).