C15H26Cl2N2O3S — CID 167323116
3,4-dichloro-2-[2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]piperidin-4-yl]cyclohexan-1-ol (PubChem CID 167323116) has the molecular formula C15H26Cl2N2O3S and a molecular weight of 385.36 g/mol. Its IUPAC name is 3,4-dichloro-2-[2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]piperidin-4-yl]cyclohexan-1-ol.
| Compound Name | 3,4-dichloro-2-[2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]piperidin-4-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 167323116 |
| Molecular Formula | C15H26Cl2N2O3S |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 3,4-dichloro-2-[2-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]piperidin-4-yl]cyclohexan-1-ol |
| SMILES | O=S1(=O)CCCN1CC1CC(C2C(O)CCC(Cl)C2Cl)CCN1 |
| InChI | InChI=1S/C15H26Cl2N2O3S/c16-12-2-3-13(20)14(15(12)17)10-4-5-18-11(8-10)9-19-6-1-7-23(19,21)22/h10-15,18,20H,1-9H2 |
| InChIKey | WECLJWABMKEDDP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|