C22H19ClN4O5 — CID 16732312
3-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]-N-(2-methoxyethyl)benzamide (PubChem CID 16732312) has the molecular formula C22H19ClN4O5 and a molecular weight of 454.87 g/mol. Its IUPAC name is 3-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 16732312 |
| Molecular Formula | C22H19ClN4O5 |
| Molecular Weight | 454.87 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 3-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cccc(Cn2[nH]c(=O)c3[nH]c4cc(Cl)ccc4c(=O)c3c2=O)c1 |
| InChI | InChI=1S/C22H19ClN4O5/c1-32-8-7-24-20(29)13-4-2-3-12(9-13)11-27-22(31)17-18(21(30)26-27)25-16-10-14(23)5-6-15(16)19(17)28/h2-6,9-10H,7-8,11H2,1H3,(H,24,29)(H,25,28)(H,26,30) |
| InChIKey | HOJQDOZZFDBKIS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.87 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|