C21H14ClN3O3 — CID 16732314
7-chloro-2-(4-phenylbut-3-yn-2-yl)-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione (PubChem CID 16732314) has the molecular formula C21H14ClN3O3 and a molecular weight of 391.81 g/mol. Its IUPAC name is 7-chloro-2-(4-phenylbut-3-yn-2-yl)-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione.
| Compound Name | 7-chloro-2-(4-phenylbut-3-yn-2-yl)-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione |
|---|---|
| PubChem CID | 16732314 |
| Molecular Formula | C21H14ClN3O3 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 7-chloro-2-(4-phenylbut-3-yn-2-yl)-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione |
| SMILES | CC(C#Cc1ccccc1)n1[nH]c(=O)c2[nH]c3cc(Cl)ccc3c(=O)c2c1=O |
| InChI | InChI=1S/C21H14ClN3O3/c1-12(7-8-13-5-3-2-4-6-13)25-21(28)17-18(20(27)24-25)23-16-11-14(22)9-10-15(16)19(17)26/h2-6,9-12H,1H3,(H,23,26)(H,24,27) |
| InChIKey | PRFHKUZGQBCNAA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|