C16H24Cl2N4O2 — CID 167323298
[4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 167323298) has the molecular formula C16H24Cl2N4O2 and a molecular weight of 375.30 g/mol. Its IUPAC name is [4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 167323298 |
| Molecular Formula | C16H24Cl2N4O2 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | N[C@H](C1CCN(C(=O)c2ccn[nH]2)CC1)C1CC(Cl)C(Cl)CC1O |
| InChI | InChI=1S/C16H24Cl2N4O2/c17-11-7-10(14(23)8-12(11)18)15(19)9-2-5-22(6-3-9)16(24)13-1-4-20-21-13/h1,4,9-12,14-15,23H,2-3,5-8,19H2,(H,20,21)/t10?,11?,12?,14?,15-/m1/s1 |
| InChIKey | RTSHWQRIMTUTTL-FNAKGOALSA-N |
| XLogP | 1.57 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|