C17H26Cl2N4O2 — CID 167323433
[4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-(5-methyl-1H-pyrazol-4-yl)methanone (PubChem CID 167323433) has the molecular formula C17H26Cl2N4O2 and a molecular weight of 389.33 g/mol. Its IUPAC name is [4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-(5-methyl-1H-pyrazol-4-yl)methanone.
| Compound Name | [4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-(5-methyl-1H-pyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 167323433 |
| Molecular Formula | C17H26Cl2N4O2 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-(5-methyl-1H-pyrazol-4-yl)methanone |
| SMILES | Cc1[nH]ncc1C(=O)N1CCC([C@@H](N)C2CC(Cl)C(Cl)CC2O)CC1 |
| InChI | InChI=1S/C17H26Cl2N4O2/c1-9-12(8-21-22-9)17(25)23-4-2-10(3-5-23)16(20)11-6-13(18)14(19)7-15(11)24/h8,10-11,13-16,24H,2-7,20H2,1H3,(H,21,22)/t11?,13?,14?,15?,16-/m1/s1 |
| InChIKey | WPHMSIPWKUWUJW-ODEZGWRHSA-N |
| XLogP | 1.88 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|