C17H28Cl2N2O4 — CID 167323441
(2R)-1-[(3aS,6aR)-5-[amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2,3-dihydroxypropan-1-one (PubChem CID 167323441) has the molecular formula C17H28Cl2N2O4 and a molecular weight of 395.33 g/mol. Its IUPAC name is (2R)-1-[(3aS,6aR)-5-[amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2,3-dihydroxypropan-1-one.
| Compound Name | (2R)-1-[(3aS,6aR)-5-[amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2,3-dihydroxypropan-1-one |
|---|---|
| PubChem CID | 167323441 |
| Molecular Formula | C17H28Cl2N2O4 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (2R)-1-[(3aS,6aR)-5-[amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2,3-dihydroxypropan-1-one |
| SMILES | NC(C1C[C@@H]2CN(C(=O)[C@H](O)CO)C[C@@H]2C1)C1CC(Cl)C(Cl)CC1O |
| InChI | InChI=1S/C17H28Cl2N2O4/c18-12-3-11(14(23)4-13(12)19)16(20)8-1-9-5-21(6-10(9)2-8)17(25)15(24)7-22/h8-16,22-24H,1-7,20H2/t8?,9-,10+,11?,12?,13?,14?,15-,16?/m1/s1 |
| InChIKey | HVPZBZMYMFBOND-QRDIYGFXSA-N |
| XLogP | 0.14 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|