C17H26Cl2F2N2O2 — CID 167323448
[4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-(3,3-difluorocyclobutyl)methanone (PubChem CID 167323448) has the molecular formula C17H26Cl2F2N2O2 and a molecular weight of 399.31 g/mol. Its IUPAC name is [4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-(3,3-difluorocyclobutyl)methanone.
| Compound Name | [4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-(3,3-difluorocyclobutyl)methanone |
|---|---|
| PubChem CID | 167323448 |
| Molecular Formula | C17H26Cl2F2N2O2 |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | [4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-(3,3-difluorocyclobutyl)methanone |
| SMILES | N[C@H](C1CCN(C(=O)C2CC(F)(F)C2)CC1)C1CC(Cl)C(Cl)CC1O |
| InChI | InChI=1S/C17H26Cl2F2N2O2/c18-12-5-11(14(24)6-13(12)19)15(22)9-1-3-23(4-2-9)16(25)10-7-17(20,21)8-10/h9-15,24H,1-8,22H2/t11?,12?,13?,14?,15-/m1/s1 |
| InChIKey | PNPGJGCAGYDTAI-ZPWMNFGTSA-N |
| XLogP | 2.58 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|