C17H25Cl2N3O2 — CID 167323515
4-[4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-1H-pyridin-2-one (PubChem CID 167323515) has the molecular formula C17H25Cl2N3O2 and a molecular weight of 374.31 g/mol. Its IUPAC name is 4-[4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-1H-pyridin-2-one.
| Compound Name | 4-[4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 167323515 |
| Molecular Formula | C17H25Cl2N3O2 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 4-[4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-1H-pyridin-2-one |
| SMILES | N[C@H](C1CCN(c2cc[nH]c(=O)c2)CC1)C1CC(Cl)C(Cl)CC1O |
| InChI | InChI=1S/C17H25Cl2N3O2/c18-13-8-12(15(23)9-14(13)19)17(20)10-2-5-22(6-3-10)11-1-4-21-16(24)7-11/h1,4,7,10,12-15,17,23H,2-3,5-6,8-9,20H2,(H,21,24)/t12?,13?,14?,15?,17-/m1/s1 |
| InChIKey | ANTMQLHYKZQMJK-UGQLREHASA-N |
| XLogP | 1.90 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|