C17H24Cl2N4O3 — CID 167323552
4-[4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-1-carbonyl]-1H-pyrimidin-6-one (PubChem CID 167323552) has the molecular formula C17H24Cl2N4O3 and a molecular weight of 403.31 g/mol. Its IUPAC name is 4-[4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-1-carbonyl]-1H-pyrimidin-6-one.
| Compound Name | 4-[4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-1-carbonyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 167323552 |
| Molecular Formula | C17H24Cl2N4O3 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 4-[4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidine-1-carbonyl]-1H-pyrimidin-6-one |
| SMILES | N[C@H](C1CCN(C(=O)c2cc(=O)[nH]cn2)CC1)C1CC(Cl)C(Cl)CC1O |
| InChI | InChI=1S/C17H24Cl2N4O3/c18-11-5-10(14(24)6-12(11)19)16(20)9-1-3-23(4-2-9)17(26)13-7-15(25)22-8-21-13/h7-12,14,16,24H,1-6,20H2,(H,21,22,25)/t10?,11?,12?,14?,16-/m1/s1 |
| InChIKey | AMFUFAPZGYNFNE-GPXZADECSA-N |
| XLogP | 0.94 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|