C8H11N3O2S — CID 16732462
4-methyl-1,1-dioxo-2,3-dihydro-1λ6,2,4-benzothiadiazin-7-amine (PubChem CID 16732462) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is 4-methyl-1,1-dioxo-2,3-dihydro-1λ6,2,4-benzothiadiazin-7-amine.
| Compound Name | 4-methyl-1,1-dioxo-2,3-dihydro-1λ6,2,4-benzothiadiazin-7-amine |
|---|---|
| PubChem CID | 16732462 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 4-methyl-1,1-dioxo-2,3-dihydro-1λ6,2,4-benzothiadiazin-7-amine |
| SMILES | CN1CNS(=O)(=O)c2cc(N)ccc21 |
| InChI | InChI=1S/C8H11N3O2S/c1-11-5-10-14(12,13)8-4-6(9)2-3-7(8)11/h2-4,10H,5,9H2,1H3 |
| InChIKey | SKNMOQUELULVIE-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|