About tert-butyl-[5,5-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane
tert-butyl-[5,5-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane (PubChem CID 16732481) has the molecular formula C24H44OSi
and a molecular weight of 376.70 g/mol. Its IUPAC name is tert-butyl-[5,5-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[5,5-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane |
| PubChem CID | 16732481 |
| Molecular Formula | C24H44OSi |
| Molecular Weight | 376.70 g/mol |
| Exact Mass | 376.32 |
| IUPAC Name | tert-butyl-[5,5-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane |
| SMILES | CC(C)=CCC1=C(O[Si](C)(C)C(C)(C)C)CC(C)(C)C(CC=C(C)C)C1 |
| InChI | InChI=1S/C24H44OSi/c1-18(2)12-14-20-16-21(15-13-19(3)4)24(8,9)17-22(20)25-26(10,11)23(5,6)7/h12-13,21H,14-17H2,1-11H3 |
| InChIKey | IAZXILAAWAPNRK-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.70 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[5,5-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[5,5-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[5,5-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane (CID 16732481) is tert-butyl-[5,5-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[5,5-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[5,5-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane is CC(C)=CCC1=C(O[Si](C)(C)C(C)(C)C)CC(C)(C)C(CC=C(C)C)C1.
What is the InChIKey of tert-butyl-[5,5-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane?
The InChIKey is IAZXILAAWAPNRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44OSi/c1-18(2)12-14-20-16-21(15-13-19(3)4)24(8,9)17-22(20)25-26(10,11)23(5,6)7/h12-13,21H,14-17H2,1-11H3.
What are the key properties of tert-butyl-[5,5-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane?
tert-butyl-[5,5-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane has a molecular weight of 376.70 g/mol, XLogP of 8.41, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[5,5-dimethyl-2,4-bis(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-dimethylsilane is sourced from PubChem (CID 16732481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).