C30H44O6Si — CID 16732519
(E)-3-[(1S,2E,4S,5S,9R,12R,14S)-9-[tert-butyl(dimethyl)silyl]oxy-4,12-dimethyl-7-oxo-14-phenyl-6,13,15-trioxabicyclo[10.3.0]pentadec-2-en-5-yl]but-2-enal (PubChem CID 16732519) has the molecular formula C30H44O6Si and a molecular weight of 528.76 g/mol. Its IUPAC name is (E)-3-[(1S,2E,4S,5S,9R,12R,14S)-9-[tert-butyl(dimethyl)silyl]oxy-4,12-dimethyl-7-oxo-14-phenyl-6,13,15-trioxabicyclo[10.3.0]pentadec-2-en-5-yl]but-2-enal.
| Compound Name | (E)-3-[(1S,2E,4S,5S,9R,12R,14S)-9-[tert-butyl(dimethyl)silyl]oxy-4,12-dimethyl-7-oxo-14-phenyl-6,13,15-trioxabicyclo[10.3.0]pentadec-2-en-5-yl]but-2-enal |
|---|---|
| PubChem CID | 16732519 |
| Molecular Formula | C30H44O6Si |
| Molecular Weight | 528.76 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | (E)-3-[(1S,2E,4S,5S,9R,12R,14S)-9-[tert-butyl(dimethyl)silyl]oxy-4,12-dimethyl-7-oxo-14-phenyl-6,13,15-trioxabicyclo[10.3.0]pentadec-2-en-5-yl]but-2-enal |
| SMILES | C/C(=C\C=O)[C@H]1OC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@]2(C)O[C@@H](c3ccccc3)O[C@H]2/C=C/[C@@H]1C |
| InChI | InChI=1S/C30H44O6Si/c1-21-14-15-25-30(6,35-28(33-25)23-12-10-9-11-13-23)18-16-24(36-37(7,8)29(3,4)5)20-26(32)34-27(21)22(2)17-19-31/h9-15,17,19,21,24-25,27-28H,16,18,20H2,1-8H3/b15-14+,22-17+/t21-,24+,25-,27-,28-,30+/m0/s1 |
| InChIKey | QMTDQADXJSWZEQ-ZRISTFNSSA-N |
| XLogP | 6.68 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.76 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|