C10H14N2O3S — CID 16732618
4-ethyl-7-methoxy-2,3-dihydro-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 16732618) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 4-ethyl-7-methoxy-2,3-dihydro-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 4-ethyl-7-methoxy-2,3-dihydro-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 16732618 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 4-ethyl-7-methoxy-2,3-dihydro-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | CCN1CNS(=O)(=O)c2cc(OC)ccc21 |
| InChI | InChI=1S/C10H14N2O3S/c1-3-12-7-11-16(13,14)10-6-8(15-2)4-5-9(10)12/h4-6,11H,3,7H2,1-2H3 |
| InChIKey | JSXOLUYPSRUBHR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|