About (4R)-4-[4-(2,6-dichloroquinazolin-7-yl)piperidin-1-yl]-4-methyloxolan-3-ol
(4R)-4-[4-(2,6-dichloroquinazolin-7-yl)piperidin-1-yl]-4-methyloxolan-3-ol (PubChem CID 167326612) has the molecular formula C18H21Cl2N3O2
and a molecular weight of 382.29 g/mol. Its IUPAC name is (4R)-4-[4-(2,6-dichloroquinazolin-7-yl)piperidin-1-yl]-4-methyloxolan-3-ol.
Molecular Properties
| Compound Name | (4R)-4-[4-(2,6-dichloroquinazolin-7-yl)piperidin-1-yl]-4-methyloxolan-3-ol |
| PubChem CID | 167326612 |
| Molecular Formula | C18H21Cl2N3O2 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (4R)-4-[4-(2,6-dichloroquinazolin-7-yl)piperidin-1-yl]-4-methyloxolan-3-ol |
| SMILES | C[C@@]1(N2CCC(c3cc4nc(Cl)ncc4cc3Cl)CC2)COCC1O |
| InChI | InChI=1S/C18H21Cl2N3O2/c1-18(10-25-9-16(18)24)23-4-2-11(3-5-23)13-7-15-12(6-14(13)19)8-21-17(20)22-15/h6-8,11,16,24H,2-5,9-10H2,1H3/t16?,18-/m1/s1 |
| InChIKey | WQCZTLSQFJCXQM-UHUGOGIASA-N |
| XLogP | 3.27 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4R)-4-[4-(2,6-dichloroquinazolin-7-yl)piperidin-1-yl]-4-methyloxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-[4-(2,6-dichloroquinazolin-7-yl)piperidin-1-yl]-4-methyloxolan-3-ol?
The IUPAC name of (4R)-4-[4-(2,6-dichloroquinazolin-7-yl)piperidin-1-yl]-4-methyloxolan-3-ol (CID 167326612) is (4R)-4-[4-(2,6-dichloroquinazolin-7-yl)piperidin-1-yl]-4-methyloxolan-3-ol.
What is the SMILES notation for (4R)-4-[4-(2,6-dichloroquinazolin-7-yl)piperidin-1-yl]-4-methyloxolan-3-ol?
The canonical SMILES for (4R)-4-[4-(2,6-dichloroquinazolin-7-yl)piperidin-1-yl]-4-methyloxolan-3-ol is C[C@@]1(N2CCC(c3cc4nc(Cl)ncc4cc3Cl)CC2)COCC1O.
What is the InChIKey of (4R)-4-[4-(2,6-dichloroquinazolin-7-yl)piperidin-1-yl]-4-methyloxolan-3-ol?
The InChIKey is WQCZTLSQFJCXQM-UHUGOGIASA-N. The full InChI is InChI=1S/C18H21Cl2N3O2/c1-18(10-25-9-16(18)24)23-4-2-11(3-5-23)13-7-15-12(6-14(13)19)8-21-17(20)22-15/h6-8,11,16,24H,2-5,9-10H2,1H3/t16?,18-/m1/s1.
What are the key properties of (4R)-4-[4-(2,6-dichloroquinazolin-7-yl)piperidin-1-yl]-4-methyloxolan-3-ol?
(4R)-4-[4-(2,6-dichloroquinazolin-7-yl)piperidin-1-yl]-4-methyloxolan-3-ol has a molecular weight of 382.29 g/mol, XLogP of 3.27, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-[4-(2,6-dichloroquinazolin-7-yl)piperidin-1-yl]-4-methyloxolan-3-ol is sourced from PubChem (CID 167326612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).