About ethyl 4-methylideneoctanoate
ethyl 4-methylideneoctanoate (PubChem CID 16732679) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is ethyl 4-methylideneoctanoate.
Molecular Properties
| Compound Name | ethyl 4-methylideneoctanoate |
| PubChem CID | 16732679 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | ethyl 4-methylideneoctanoate |
| SMILES | C=C(CCCC)CCC(=O)OCC |
| InChI | InChI=1S/C11H20O2/c1-4-6-7-10(3)8-9-11(12)13-5-2/h3-9H2,1-2H3 |
| InChIKey | ZBTMJAFADYUCBI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-methylideneoctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-methylideneoctanoate?
The IUPAC name of ethyl 4-methylideneoctanoate (CID 16732679) is ethyl 4-methylideneoctanoate.
What is the SMILES notation for ethyl 4-methylideneoctanoate?
The canonical SMILES for ethyl 4-methylideneoctanoate is C=C(CCCC)CCC(=O)OCC.
What is the InChIKey of ethyl 4-methylideneoctanoate?
The InChIKey is ZBTMJAFADYUCBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-4-6-7-10(3)8-9-11(12)13-5-2/h3-9H2,1-2H3.
What are the key properties of ethyl 4-methylideneoctanoate?
ethyl 4-methylideneoctanoate has a molecular weight of 184.28 g/mol, XLogP of 3.08, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-methylideneoctanoate is sourced from PubChem (CID 16732679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).