About lithium;[2-(1,1-difluoroethyl)-1,3-oxazol-4-yl]methanone;hydroxide
lithium;[2-(1,1-difluoroethyl)-1,3-oxazol-4-yl]methanone;hydroxide (PubChem CID 167327351) has the molecular formula C6H5F2LiNO3-
and a molecular weight of 184.05 g/mol. Its IUPAC name is lithium;[2-(1,1-difluoroethyl)-1,3-oxazol-4-yl]methanone;hydroxide.
Molecular Properties
| Compound Name | lithium;[2-(1,1-difluoroethyl)-1,3-oxazol-4-yl]methanone;hydroxide |
| PubChem CID | 167327351 |
| Molecular Formula | C6H5F2LiNO3- |
| Molecular Weight | 184.05 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | lithium;[2-(1,1-difluoroethyl)-1,3-oxazol-4-yl]methanone;hydroxide |
| SMILES | CC(F)(F)c1nc([C-]=O)co1.[Li+].[OH-] |
| InChI | InChI=1S/C6H4F2NO2.Li.H2O/c1-6(7,8)5-9-4(2-10)3-11-5;;/h3H,1H3;;1H2/q-1;+1;/p-1 |
| InChIKey | AWZDHUHFWLJDJG-UHFFFAOYSA-M |
| XLogP | -1.93 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.05 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium;[2-(1,1-difluoroethyl)-1,3-oxazol-4-yl]methanone;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;[2-(1,1-difluoroethyl)-1,3-oxazol-4-yl]methanone;hydroxide?
The IUPAC name of lithium;[2-(1,1-difluoroethyl)-1,3-oxazol-4-yl]methanone;hydroxide (CID 167327351) is lithium;[2-(1,1-difluoroethyl)-1,3-oxazol-4-yl]methanone;hydroxide.
What is the SMILES notation for lithium;[2-(1,1-difluoroethyl)-1,3-oxazol-4-yl]methanone;hydroxide?
The canonical SMILES for lithium;[2-(1,1-difluoroethyl)-1,3-oxazol-4-yl]methanone;hydroxide is CC(F)(F)c1nc([C-]=O)co1.[Li+].[OH-].
What is the InChIKey of lithium;[2-(1,1-difluoroethyl)-1,3-oxazol-4-yl]methanone;hydroxide?
The InChIKey is AWZDHUHFWLJDJG-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H4F2NO2.Li.H2O/c1-6(7,8)5-9-4(2-10)3-11-5;;/h3H,1H3;;1H2/q-1;+1;/p-1.
What are the key properties of lithium;[2-(1,1-difluoroethyl)-1,3-oxazol-4-yl]methanone;hydroxide?
lithium;[2-(1,1-difluoroethyl)-1,3-oxazol-4-yl]methanone;hydroxide has a molecular weight of 184.05 g/mol, XLogP of -1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;[2-(1,1-difluoroethyl)-1,3-oxazol-4-yl]methanone;hydroxide is sourced from PubChem (CID 167327351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).