C9H12F4N2O3 — CID 167327463
(3S)-3-(methylamino)-4-oxo-4-(3,3,4,4-tetrafluoropyrrolidin-1-yl)butanoic acid (PubChem CID 167327463) has the molecular formula C9H12F4N2O3 and a molecular weight of 272.20 g/mol. Its IUPAC name is (3S)-3-(methylamino)-4-oxo-4-(3,3,4,4-tetrafluoropyrrolidin-1-yl)butanoic acid.
| Compound Name | (3S)-3-(methylamino)-4-oxo-4-(3,3,4,4-tetrafluoropyrrolidin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 167327463 |
| Molecular Formula | C9H12F4N2O3 |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (3S)-3-(methylamino)-4-oxo-4-(3,3,4,4-tetrafluoropyrrolidin-1-yl)butanoic acid |
| SMILES | CN[C@@H](CC(=O)O)C(=O)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C9H12F4N2O3/c1-14-5(2-6(16)17)7(18)15-3-8(10,11)9(12,13)4-15/h5,14H,2-4H2,1H3,(H,16,17)/t5-/m0/s1 |
| InChIKey | HNMHDRGMYYBVOU-YFKPBYRVSA-N |
| XLogP | 0.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|