About cis-(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol
cis-(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol (PubChem CID 16732844) has the molecular formula C11H24O2Si
and a molecular weight of 216.40 g/mol. Its IUPAC name is cis-(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol.
Molecular Properties
| Compound Name | cis-(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol |
| PubChem CID | 16732844 |
| Molecular Formula | C11H24O2Si |
| Molecular Weight | 216.40 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | cis-(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@H]1O |
| InChI | InChI=1S/C11H24O2Si/c1-11(2,3)14(4,5)13-10-8-6-7-9(10)12/h9-10,12H,6-8H2,1-5H3/t9-,10+/m1/s1 |
| InChIKey | BYCGIGSARPYWEN-ZJUUUORDSA-N |
| XLogP | 2.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cis-(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol?
The IUPAC name of cis-(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol (CID 16732844) is cis-(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol.
What is the SMILES notation for cis-(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol?
The canonical SMILES for cis-(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol is CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@H]1O.
What is the InChIKey of cis-(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol?
The InChIKey is BYCGIGSARPYWEN-ZJUUUORDSA-N. The full InChI is InChI=1S/C11H24O2Si/c1-11(2,3)14(4,5)13-10-8-6-7-9(10)12/h9-10,12H,6-8H2,1-5H3/t9-,10+/m1/s1.
What are the key properties of cis-(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol?
cis-(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol has a molecular weight of 216.40 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol is sourced from PubChem (CID 16732844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).