C56H37N5 — CID 167328823
10-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,2,5-triphenylpyrazolo[5,1-a]isoquinoline (PubChem CID 167328823) has the molecular formula C56H37N5 and a molecular weight of 779.95 g/mol. Its IUPAC name is 10-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,2,5-triphenylpyrazolo[5,1-a]isoquinoline.
| Compound Name | 10-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,2,5-triphenylpyrazolo[5,1-a]isoquinoline |
|---|---|
| PubChem CID | 167328823 |
| Molecular Formula | C56H37N5 |
| Molecular Weight | 779.95 g/mol |
| Exact Mass | 779.30 |
| IUPAC Name | 10-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,2,5-triphenylpyrazolo[5,1-a]isoquinoline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4cccc(-c5cccc6cc(-c7ccccc7)n7nc(-c8ccccc8)c(-c8ccccc8)c7c56)c4)c3)n2)cc1 |
| InChI | InChI=1S/C56H37N5/c1-6-19-38(20-7-1)49-37-46-32-18-34-48(50(46)53-51(39-21-8-2-9-22-39)52(60-61(49)53)40-23-10-3-11-24-40)45-31-16-29-43(35-45)44-30-17-33-47(36-44)56-58-54(41-25-12-4-13-26-41)57-55(59-56)42-27-14-5-15-28-42/h1-37H |
| InChIKey | MMKYFZAFRBBPRJ-UHFFFAOYSA-N |
| XLogP | 14.01 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.95 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |