C9H11F3N2O4 — CID 16732888
3-(2,6-dimethoxypyrimidin-4-yl)-1,1,1-trifluoropropane-2,2-diol (PubChem CID 16732888) has the molecular formula C9H11F3N2O4 and a molecular weight of 268.19 g/mol. Its IUPAC name is 3-(2,6-dimethoxypyrimidin-4-yl)-1,1,1-trifluoropropane-2,2-diol.
| Compound Name | 3-(2,6-dimethoxypyrimidin-4-yl)-1,1,1-trifluoropropane-2,2-diol |
|---|---|
| PubChem CID | 16732888 |
| Molecular Formula | C9H11F3N2O4 |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 3-(2,6-dimethoxypyrimidin-4-yl)-1,1,1-trifluoropropane-2,2-diol |
| SMILES | COc1cc(CC(O)(O)C(F)(F)F)nc(OC)n1 |
| InChI | InChI=1S/C9H11F3N2O4/c1-17-6-3-5(13-7(14-6)18-2)4-8(15,16)9(10,11)12/h3,15-16H,4H2,1-2H3 |
| InChIKey | CMURECDYKKXTJU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|