C7H10O4S — CID 167328938
(2R,3S,4R,5S,6S)-6-ethynylthiane-2,3,4,5-tetrol (PubChem CID 167328938) has the molecular formula C7H10O4S and a molecular weight of 190.22 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S)-6-ethynylthiane-2,3,4,5-tetrol.
| Compound Name | (2R,3S,4R,5S,6S)-6-ethynylthiane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 167328938 |
| Molecular Formula | C7H10O4S |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | (2R,3S,4R,5S,6S)-6-ethynylthiane-2,3,4,5-tetrol |
| SMILES | C#C[C@@H]1S[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H10O4S/c1-2-3-4(8)5(9)6(10)7(11)12-3/h1,3-11H/t3-,4+,5+,6-,7+/m0/s1 |
| InChIKey | CKYBUPSJDFQMJD-CXNFULCWSA-N |
| XLogP | -1.86 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|