C17H34O7 — CID 16732978
(2R,3S,5S,6R,7S)-3,7,9,9-tetramethoxy-5-(methoxymethoxy)-2,6-dimethylnonanal (PubChem CID 16732978) has the molecular formula C17H34O7 and a molecular weight of 350.45 g/mol. Its IUPAC name is (2R,3S,5S,6R,7S)-3,7,9,9-tetramethoxy-5-(methoxymethoxy)-2,6-dimethylnonanal.
| Compound Name | (2R,3S,5S,6R,7S)-3,7,9,9-tetramethoxy-5-(methoxymethoxy)-2,6-dimethylnonanal |
|---|---|
| PubChem CID | 16732978 |
| Molecular Formula | C17H34O7 |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (2R,3S,5S,6R,7S)-3,7,9,9-tetramethoxy-5-(methoxymethoxy)-2,6-dimethylnonanal |
| SMILES | COCO[C@@H](C[C@H](OC)C(C)C=O)[C@H](C)[C@H](CC(OC)OC)OC |
| InChI | InChI=1S/C17H34O7/c1-12(10-18)14(20-4)8-16(24-11-19-3)13(2)15(21-5)9-17(22-6)23-7/h10,12-17H,8-9,11H2,1-7H3/t12?,13-,14+,15+,16+/m1/s1 |
| InChIKey | NDBBUKLVECHWOK-LQFWQHRQSA-N |
| XLogP | 1.88 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|