C22H38O4Si — CID 16733199
(3aR,5aR,6S,7S,9aS,9bS)-6,9a,9b-trimethyl-1-oxo-7-triethylsilyloxy-3,3a,4,5,5a,7,8,9-octahydrobenzo[e][2]benzofuran-6-carbaldehyde (PubChem CID 16733199) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is (3aR,5aR,6S,7S,9aS,9bS)-6,9a,9b-trimethyl-1-oxo-7-triethylsilyloxy-3,3a,4,5,5a,7,8,9-octahydrobenzo[e][2]benzofuran-6-carbaldehyde.
| Compound Name | (3aR,5aR,6S,7S,9aS,9bS)-6,9a,9b-trimethyl-1-oxo-7-triethylsilyloxy-3,3a,4,5,5a,7,8,9-octahydrobenzo[e][2]benzofuran-6-carbaldehyde |
|---|---|
| PubChem CID | 16733199 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (3aR,5aR,6S,7S,9aS,9bS)-6,9a,9b-trimethyl-1-oxo-7-triethylsilyloxy-3,3a,4,5,5a,7,8,9-octahydrobenzo[e][2]benzofuran-6-carbaldehyde |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@H]3COC(=O)[C@@]32C)[C@]1(C)C=O |
| InChI | InChI=1S/C22H38O4Si/c1-7-27(8-2,9-3)26-18-12-13-21(5)17(20(18,4)15-23)11-10-16-14-25-19(24)22(16,21)6/h15-18H,7-14H2,1-6H3/t16-,17-,18-,20-,21-,22+/m0/s1 |
| InChIKey | NXAKLCCMXHAYAP-XHQZWYKSSA-N |
| XLogP | 4.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|