About 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylate
4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylate (PubChem CID 167333120) has the molecular formula C13H16NO4-
and a molecular weight of 250.27 g/mol. Its IUPAC name is 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylate |
| PubChem CID | 167333120 |
| Molecular Formula | C13H16NO4- |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylate |
| SMILES | CC1=C(C)C(=O)N(C2CCC(C(=O)[O-])CC2)C1=O |
| InChI | InChI=1S/C13H17NO4/c1-7-8(2)12(16)14(11(7)15)10-5-3-9(4-6-10)13(17)18/h9-10H,3-6H2,1-2H3,(H,17,18)/p-1 |
| InChIKey | CVONPSVTRPLXKC-UHFFFAOYSA-M |
| XLogP | 0.00 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylate?
The IUPAC name of 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylate (CID 167333120) is 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylate.
What is the SMILES notation for 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylate?
The canonical SMILES for 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylate is CC1=C(C)C(=O)N(C2CCC(C(=O)[O-])CC2)C1=O.
What is the InChIKey of 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylate?
The InChIKey is CVONPSVTRPLXKC-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H17NO4/c1-7-8(2)12(16)14(11(7)15)10-5-3-9(4-6-10)13(17)18/h9-10H,3-6H2,1-2H3,(H,17,18)/p-1.
What are the key properties of 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylate?
4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylate has a molecular weight of 250.27 g/mol, XLogP of 0.00, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylate is sourced from PubChem (CID 167333120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).