C15H9F4NO4 — CID 167333138
4-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-2,3,5,6-tetrafluorobenzoic acid (PubChem CID 167333138) has the molecular formula C15H9F4NO4 and a molecular weight of 343.23 g/mol. Its IUPAC name is 4-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-2,3,5,6-tetrafluorobenzoic acid.
| Compound Name | 4-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-2,3,5,6-tetrafluorobenzoic acid |
|---|---|
| PubChem CID | 167333138 |
| Molecular Formula | C15H9F4NO4 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 4-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-2,3,5,6-tetrafluorobenzoic acid |
| SMILES | O=C(O)c1c(F)c(F)c(N2C(=O)C3=C(CCCC3)C2=O)c(F)c1F |
| InChI | InChI=1S/C15H9F4NO4/c16-8-7(15(23)24)9(17)11(19)12(10(8)18)20-13(21)5-3-1-2-4-6(5)14(20)22/h1-4H2,(H,23,24) |
| InChIKey | WIMLMWOJSUWKLO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|