C27H30ClN5O5 — CID 16733318
tert-butyl N-[(4-aminophenyl)methyl-[7-chloro-4-oxo-2-(pyrrolidine-1-carbonyl)-1H-quinoline-3-carbonyl]amino]carbamate (PubChem CID 16733318) has the molecular formula C27H30ClN5O5 and a molecular weight of 540.02 g/mol. Its IUPAC name is tert-butyl N-[(4-aminophenyl)methyl-[7-chloro-4-oxo-2-(pyrrolidine-1-carbonyl)-1H-quinoline-3-carbonyl]amino]carbamate.
| Compound Name | tert-butyl N-[(4-aminophenyl)methyl-[7-chloro-4-oxo-2-(pyrrolidine-1-carbonyl)-1H-quinoline-3-carbonyl]amino]carbamate |
|---|---|
| PubChem CID | 16733318 |
| Molecular Formula | C27H30ClN5O5 |
| Molecular Weight | 540.02 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | tert-butyl N-[(4-aminophenyl)methyl-[7-chloro-4-oxo-2-(pyrrolidine-1-carbonyl)-1H-quinoline-3-carbonyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(Cc1ccc(N)cc1)C(=O)c1c(C(=O)N2CCCC2)[nH]c2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C27H30ClN5O5/c1-27(2,3)38-26(37)31-33(15-16-6-9-18(29)10-7-16)24(35)21-22(25(36)32-12-4-5-13-32)30-20-14-17(28)8-11-19(20)23(21)34/h6-11,14H,4-5,12-13,15,29H2,1-3H3,(H,30,34)(H,31,37) |
| InChIKey | BIYIBXLCLGSXBI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 137.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.02 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|